C15H12ClN3O5 — CID 3411161
methyl 1-acetyl-5-(4-chlorophenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 3411161) has the molecular formula C15H12ClN3O5 and a molecular weight of 349.73 g/mol. Its IUPAC name is methyl 1-acetyl-5-(4-chlorophenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl 1-acetyl-5-(4-chlorophenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 3411161 |
| Molecular Formula | C15H12ClN3O5 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | methyl 1-acetyl-5-(4-chlorophenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=C2C(=O)N(c3ccc(Cl)cc3)C(=O)C2N(C(C)=O)N1 |
| InChI | InChI=1S/C15H12ClN3O5/c1-7(20)19-12-10(11(17-19)15(23)24-2)13(21)18(14(12)22)9-5-3-8(16)4-6-9/h3-6,12,17H,1-2H3 |
| InChIKey | AVBAESJLRDYEES-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|