C20H23N3OS2 — CID 3412030
5-butyl-3-[(2-methylphenyl)methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 3412030) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 5-butyl-3-[(2-methylphenyl)methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | 5-butyl-3-[(2-methylphenyl)methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3412030 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 5-butyl-3-[(2-methylphenyl)methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | CCCCC1SC(=NN=Cc2cccs2)N(Cc2ccccc2C)C1=O |
| InChI | InChI=1S/C20H23N3OS2/c1-3-4-11-18-19(24)23(14-16-9-6-5-8-15(16)2)20(26-18)22-21-13-17-10-7-12-25-17/h5-10,12-13,18H,3-4,11,14H2,1-2H3 |
| InChIKey | ISUKVHSUZDVZOS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|