C23H26BrN3O2S — CID 46861478
(2Z)-2-[(E)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-butyl-3-[(2-methylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 46861478) has the molecular formula C23H26BrN3O2S and a molecular weight of 488.45 g/mol. Its IUPAC name is (2Z)-2-[(E)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-butyl-3-[(2-methylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-butyl-3-[(2-methylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 46861478 |
| Molecular Formula | C23H26BrN3O2S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (2Z)-2-[(E)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-butyl-3-[(2-methylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCCC1S/C(=N\N=C\c2cc(Br)ccc2OC)N(Cc2ccccc2C)C1=O |
| InChI | InChI=1S/C23H26BrN3O2S/c1-4-5-10-21-22(28)27(15-17-9-7-6-8-16(17)2)23(30-21)26-25-14-18-13-19(24)11-12-20(18)29-3/h6-9,11-14,21H,4-5,10,15H2,1-3H3/b25-14+,26-23- |
| InChIKey | UERXLIRAJGJPEI-YMAOWCHGSA-N |
| XLogP | 5.79 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|