C22H24BrN3O2S — CID 39103625
(2Z,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(2-methylphenyl)methyl]-5-propyl-1,3-thiazolidin-4-one (PubChem CID 39103625) has the molecular formula C22H24BrN3O2S and a molecular weight of 474.42 g/mol. Its IUPAC name is (2Z,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(2-methylphenyl)methyl]-5-propyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(2-methylphenyl)methyl]-5-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 39103625 |
| Molecular Formula | C22H24BrN3O2S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (2Z,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(2-methylphenyl)methyl]-5-propyl-1,3-thiazolidin-4-one |
| SMILES | CCC[C@H]1S/C(=N\N=C/c2cc(Br)ccc2OC)N(Cc2ccccc2C)C1=O |
| InChI | InChI=1S/C22H24BrN3O2S/c1-4-7-20-21(27)26(14-16-9-6-5-8-15(16)2)22(29-20)25-24-13-17-12-18(23)10-11-19(17)28-3/h5-6,8-13,20H,4,7,14H2,1-3H3/b24-13-,25-22-/t20-/m1/s1 |
| InChIKey | WZMLRHOGDCCBTN-YAYIDYFESA-N |
| XLogP | 5.40 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|