C23H20BrN3O2S — CID 6581784
(2E,5S)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-methyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 6581784) has the molecular formula C23H20BrN3O2S and a molecular weight of 482.40 g/mol. Its IUPAC name is (2E,5S)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-methyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-methyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6581784 |
| Molecular Formula | C23H20BrN3O2S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | (2E,5S)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-5-methyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(Br)cc1/C=N\N=C1\S[C@@H](C)C(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H20BrN3O2S/c1-15-22(28)27(14-17-8-5-7-16-6-3-4-9-20(16)17)23(30-15)26-25-13-18-12-19(24)10-11-21(18)29-2/h3-13,15H,14H2,1-2H3/b25-13-,26-23+/t15-/m0/s1 |
| InChIKey | GDFOLGCBAKLQLZ-VWKWHXGPSA-N |
| XLogP | 5.46 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|