C23H20BrN3OS — CID 3724860
2-[(4-bromophenyl)methylidenehydrazinylidene]-5-ethyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 3724860) has the molecular formula C23H20BrN3OS and a molecular weight of 466.40 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylidenehydrazinylidene]-5-ethyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[(4-bromophenyl)methylidenehydrazinylidene]-5-ethyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3724860 |
| Molecular Formula | C23H20BrN3OS |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 2-[(4-bromophenyl)methylidenehydrazinylidene]-5-ethyl-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CCC1SC(=NN=Cc2ccc(Br)cc2)N(Cc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C23H20BrN3OS/c1-2-21-22(28)27(15-18-8-5-7-17-6-3-4-9-20(17)18)23(29-21)26-25-14-16-10-12-19(24)13-11-16/h3-14,21H,2,15H2,1H3 |
| InChIKey | UTPGHJHEAGQVEP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|