C19H17BrFN3O2S — CID 51666822
(2E,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one (PubChem CID 51666822) has the molecular formula C19H17BrFN3O2S and a molecular weight of 450.33 g/mol. Its IUPAC name is (2E,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 51666822 |
| Molecular Formula | C19H17BrFN3O2S |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | (2E,5R)-2-[(Z)-(5-bromo-2-methoxyphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(Br)cc1/C=N\N=C1\S[C@H](C)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17BrFN3O2S/c1-12-18(25)24(11-13-3-6-16(21)7-4-13)19(27-12)23-22-10-14-9-15(20)5-8-17(14)26-2/h3-10,12H,11H2,1-2H3/b22-10-,23-19+/t12-/m1/s1 |
| InChIKey | OKKNYVWPIKEERW-DYIPLJQFSA-N |
| XLogP | 4.45 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|