C23H21N3O4S — CID 34124254
2-(1-formylnaphthalen-2-yl)oxy-N-propyl-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]acetamide (PubChem CID 34124254) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-(1-formylnaphthalen-2-yl)oxy-N-propyl-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]acetamide.
| Compound Name | 2-(1-formylnaphthalen-2-yl)oxy-N-propyl-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 34124254 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(1-formylnaphthalen-2-yl)oxy-N-propyl-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]acetamide |
| SMILES | CCCN(Cc1nnc(-c2cccs2)o1)C(=O)COc1ccc2ccccc2c1C=O |
| InChI | InChI=1S/C23H21N3O4S/c1-2-11-26(13-21-24-25-23(30-21)20-8-5-12-31-20)22(28)15-29-19-10-9-16-6-3-4-7-17(16)18(19)14-27/h3-10,12,14H,2,11,13,15H2,1H3 |
| InChIKey | YYBXSHVTBDYBJS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|