C21H15FN2O5S2 — CID 3412686
methyl 2-[4-[(4-fluorophenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3412686) has the molecular formula C21H15FN2O5S2 and a molecular weight of 458.49 g/mol. Its IUPAC name is methyl 2-[4-[(4-fluorophenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[4-[(4-fluorophenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3412686 |
| Molecular Formula | C21H15FN2O5S2 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | methyl 2-[4-[(4-fluorophenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(F)cc3)C2c2cccs2)nc1C |
| InChI | InChI=1S/C21H15FN2O5S2/c1-10-18(20(28)29-2)31-21(23-10)24-15(13-4-3-9-30-13)14(17(26)19(24)27)16(25)11-5-7-12(22)8-6-11/h3-9,15,25H,1-2H3 |
| InChIKey | OXARCYNSLOEVDY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|