C29H24N2O6S2 — CID 6190602
methyl 2-[(4E)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6190602) has the molecular formula C29H24N2O6S2 and a molecular weight of 560.65 g/mol. Its IUPAC name is methyl 2-[(4E)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(4E)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6190602 |
| Molecular Formula | C29H24N2O6S2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | methyl 2-[(4E)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCc4cccc(C)c4)cc3)C2c2cccs2)nc1C |
| InChI | InChI=1S/C29H24N2O6S2/c1-16-6-4-7-18(14-16)15-37-20-11-9-19(10-12-20)24(32)22-23(21-8-5-13-38-21)31(27(34)25(22)33)29-30-17(2)26(39-29)28(35)36-3/h4-14,23,32H,15H2,1-3H3/b24-22+ |
| InChIKey | VLBVVAMUWXMJDY-ZNTNEXAZSA-N |
| XLogP | 5.81 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|