C31H28N2O7S — CID 6191185
ethyl 2-[(3E)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6191185) has the molecular formula C31H28N2O7S and a molecular weight of 572.64 g/mol. Its IUPAC name is ethyl 2-[(3E)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(3E)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6191185 |
| Molecular Formula | C31H28N2O7S |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | ethyl 2-[(3E)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCc4cccc(C)c4)cc3)C2c2ccc(C)o2)nc1C |
| InChI | InChI=1S/C31H28N2O7S/c1-5-38-30(37)28-19(4)32-31(41-28)33-25(23-14-9-18(3)40-23)24(27(35)29(33)36)26(34)21-10-12-22(13-11-21)39-16-20-8-6-7-17(2)15-20/h6-15,25,34H,5,16H2,1-4H3/b26-24+ |
| InChIKey | KFOHDQIYEONMQM-SHHOIMCASA-N |
| XLogP | 6.04 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|