C19H23FN4O4S — CID 3413385
[2-(diethylamino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3413385) has the molecular formula C19H23FN4O4S and a molecular weight of 422.48 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3413385 |
| Molecular Formula | C19H23FN4O4S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | CCN(CC)C(=O)CS/C(=N\c1ccc(F)cc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H23FN4O4S/c1-5-24(6-2)14(25)11-29-16(21-13-9-7-12(20)8-10-13)15-17(26)22(3)19(28)23(4)18(15)27/h7-10,26H,5-6,11H2,1-4H3/b21-16- |
| InChIKey | HWFITFFGGPNHRU-PGMHBOJBSA-N |
| XLogP | 1.61 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|