C36H32N8O13 — CID 3415110
2,8-bis[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3415110) has the molecular formula C36H32N8O13 and a molecular weight of 784.69 g/mol. Its IUPAC name is 2,8-bis[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3415110 |
| Molecular Formula | C36H32N8O13 |
| Molecular Weight | 784.69 g/mol |
| Exact Mass | 784.21 |
| IUPAC Name | 2,8-bis[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN(C)c1c([N+](=O)[O-])cc(N2C(=O)C3CC=C4C(CC5C(=O)N(c6cc([N+](=O)[O-])c(N(C)C)c([N+](=O)[O-])c6)C(=O)C5C4c4ccc(O)cc4)C3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C36H32N8O13/c1-37(2)31-24(41(50)51)11-17(12-25(31)42(52)53)39-33(46)21-10-9-20-22(29(21)35(39)48)15-23-30(28(20)16-5-7-19(45)8-6-16)36(49)40(34(23)47)18-13-26(43(54)55)32(38(3)4)27(14-18)44(56)57/h5-9,11-14,21-23,28-30,45H,10,15H2,1-4H3 |
| InChIKey | NROHQHLPMCDYMI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 274.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|