C31H26N4O9 — CID 5091410
2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5091410) has the molecular formula C31H26N4O9 and a molecular weight of 598.57 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5091410 |
| Molecular Formula | C31H26N4O9 |
| Molecular Weight | 598.57 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-(4-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(CC3C(=CCC4C(=O)N(c5cc([N+](=O)[O-])c(N(C)C)c([N+](=O)[O-])c5)C(=O)C43)C2c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C31H26N4O9/c1-14-10-24(37)27-21(29(14)38)13-20-18(25(27)15-4-6-17(36)7-5-15)8-9-19-26(20)31(40)33(30(19)39)16-11-22(34(41)42)28(32(2)3)23(12-16)35(43)44/h4-8,10-12,19-20,25-26,36H,9,13H2,1-3H3 |
| InChIKey | PADHALKPEQDISQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|