C19H20ClN3O6S — CID 34159763
methyl 5-[[(2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoyl]amino]-2-chlorobenzoate (PubChem CID 34159763) has the molecular formula C19H20ClN3O6S and a molecular weight of 453.90 g/mol. Its IUPAC name is methyl 5-[[(2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoyl]amino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[(2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 34159763 |
| Molecular Formula | C19H20ClN3O6S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | methyl 5-[[(2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoyl]amino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)[C@H](C)NS(=O)(=O)c2ccc(NC(C)=O)cc2)ccc1Cl |
| InChI | InChI=1S/C19H20ClN3O6S/c1-11(18(25)22-14-6-9-17(20)16(10-14)19(26)29-3)23-30(27,28)15-7-4-13(5-8-15)21-12(2)24/h4-11,23H,1-3H3,(H,21,24)(H,22,25)/t11-/m0/s1 |
| InChIKey | RJMPYMHONQAJIZ-NSHDSACASA-N |
| XLogP | 2.39 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |