C21H30O2 — CID 34179280
(2S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-2-methyl-7,8-dihydro-6H-chromen-5-one (PubChem CID 34179280) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (2S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-2-methyl-7,8-dihydro-6H-chromen-5-one.
| Compound Name | (2S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-2-methyl-7,8-dihydro-6H-chromen-5-one |
|---|---|
| PubChem CID | 34179280 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (2S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-2-methyl-7,8-dihydro-6H-chromen-5-one |
| SMILES | CC(C)=CCC/C=C(\C)CC[C@@]1(C)C=CC2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C21H30O2/c1-16(2)8-5-6-9-17(3)12-14-21(4)15-13-18-19(22)10-7-11-20(18)23-21/h8-9,13,15H,5-7,10-12,14H2,1-4H3/b17-9+/t21-/m0/s1 |
| InChIKey | LMGHOOQOKDPHHC-XHNXRLJJSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|