C18H16FNO5S — CID 34188198
N-(2-fluoro-5-methylsulfonylphenyl)-3-(methoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 34188198) has the molecular formula C18H16FNO5S and a molecular weight of 377.39 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-3-(methoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 34188198 |
| Molecular Formula | C18H16FNO5S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | COCc1c(C(=O)Nc2cc(S(C)(=O)=O)ccc2F)oc2ccccc12 |
| InChI | InChI=1S/C18H16FNO5S/c1-24-10-13-12-5-3-4-6-16(12)25-17(13)18(21)20-15-9-11(26(2,22)23)7-8-14(15)19/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | YFLJVIQUVNVOIO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |