C26H25NO3 — CID 3418889
methyl 4-[3-(3,3-diphenylpropylamino)-3-oxoprop-1-enyl]benzoate (PubChem CID 3418889) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is methyl 4-[3-(3,3-diphenylpropylamino)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[3-(3,3-diphenylpropylamino)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 3418889 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl 4-[3-(3,3-diphenylpropylamino)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=CC(=O)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25NO3/c1-30-26(29)23-15-12-20(13-16-23)14-17-25(28)27-19-18-24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-17,24H,18-19H2,1H3,(H,27,28) |
| InChIKey | SVPLLIIKSMNXBQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|