C21H24N2O4S — CID 34189686
N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 34189686) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 34189686 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | CCN(C(=O)CCc1cc(OC)c(OC)c(OC)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H24N2O4S/c1-5-23(21-22-15-8-6-7-9-18(15)28-21)19(24)11-10-14-12-16(25-2)20(27-4)17(13-14)26-3/h6-9,12-13H,5,10-11H2,1-4H3 |
| InChIKey | MPVMNKUXQJDWKZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |