C28H32N2O4S — CID 3420426
N-(3-ethoxypropyl)-3-methoxy-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzamide (PubChem CID 3420426) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-methoxy-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzamide.
| Compound Name | N-(3-ethoxypropyl)-3-methoxy-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 3420426 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | N-(3-ethoxypropyl)-3-methoxy-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzamide |
| SMILES | CCOCCCN(CC(=O)N1CCc2sccc2C1c1ccccc1)C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C28H32N2O4S/c1-3-34-17-8-15-29(28(32)22-11-7-12-23(19-22)33-2)20-26(31)30-16-13-25-24(14-18-35-25)27(30)21-9-5-4-6-10-21/h4-7,9-12,14,18-19,27H,3,8,13,15-17,20H2,1-2H3 |
| InChIKey | TUEUXWLBWPWUBU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|