C23H35ClN2O12 — CID 3420538
2-(4-chloro-2-methylphenoxy)-N-[[2,3,5,6-tetrahydroxy-4-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexylidene]amino]acetamide (PubChem CID 3420538) has the molecular formula C23H35ClN2O12 and a molecular weight of 566.99 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[[2,3,5,6-tetrahydroxy-4-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexylidene]amino]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[[2,3,5,6-tetrahydroxy-4-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexylidene]amino]acetamide |
|---|---|
| PubChem CID | 3420538 |
| Molecular Formula | C23H35ClN2O12 |
| Molecular Weight | 566.99 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[[2,3,5,6-tetrahydroxy-4-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexylidene]amino]acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NN=CC(O)C(O)C(COCC1OC(CO)C(O)C(O)C1O)C(O)CO |
| InChI | InChI=1S/C23H35ClN2O12/c1-11-4-12(24)2-3-16(11)37-10-19(31)26-25-5-14(29)20(32)13(15(30)6-27)8-36-9-18-22(34)23(35)21(33)17(7-28)38-18/h2-5,13-15,17-18,20-23,27-30,32-35H,6-10H2,1H3,(H,26,31) |
| InChIKey | ZZAJJGXEZVBJNW-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 230.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.99 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|