C24H26N4O2 — CID 3421186
9-(2,4-dimethylphenyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 3421186) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 9-(2,4-dimethylphenyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | 9-(2,4-dimethylphenyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 3421186 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 9-(2,4-dimethylphenyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCC(CCC)CC2C1(C#N)C(C#N)(C#N)C(c1ccc(C)cc1C)O3 |
| InChI | InChI=1S/C24H26N4O2/c1-4-5-17-8-9-24-19(11-17)23(14-27,21(28)30-24)22(12-25,13-26)20(29-24)18-7-6-15(2)10-16(18)3/h6-7,10,17,19-20,28H,4-5,8-9,11H2,1-3H3/b28-21+ |
| InChIKey | DOQMUKLGMXGGBA-SGWCAAJKSA-N |
| XLogP | 4.84 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|