C23H26N4O2 — CID 3422935
9-(2-bicyclo[2.2.1]hept-5-enyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 3422935) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 9-(2-bicyclo[2.2.1]hept-5-enyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | 9-(2-bicyclo[2.2.1]hept-5-enyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 3422935 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 9-(2-bicyclo[2.2.1]hept-5-enyl)-12-imino-4-propyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCC(CCC)CC2C1(C#N)C(C#N)(C#N)C(C1CC2C=CC1C2)O3 |
| InChI | InChI=1S/C23H26N4O2/c1-2-3-14-6-7-23-18(10-14)22(13-26,20(27)29-23)21(11-24,12-25)19(28-23)17-9-15-4-5-16(17)8-15/h4-5,14-19,27H,2-3,6-10H2,1H3/b27-20+ |
| InChIKey | HVIGUPXALGEMRK-NHFJDJAPSA-N |
| XLogP | 4.06 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|