C30H37N3O7S — CID 3421559
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide (PubChem CID 3421559) has the molecular formula C30H37N3O7S and a molecular weight of 583.71 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 3421559 |
| Molecular Formula | C30H37N3O7S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide |
| SMILES | CCOCCCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1ccc(C)s1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H37N3O7S/c1-5-40-17-7-15-32(30(35)24-8-6-9-25(19-24)33(36)37)21-29(34)31(20-26-12-10-22(2)41-26)16-14-23-11-13-27(38-3)28(18-23)39-4/h6,8-13,18-19H,5,7,14-17,20-21H2,1-4H3 |
| InChIKey | NZQUQZPCSZSWFO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|