C23H23FN2O2 — CID 3422102
4-[3-(3-fluorophenyl)-8-methoxy-1,3,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one (PubChem CID 3422102) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)-8-methoxy-1,3,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one.
| Compound Name | 4-[3-(3-fluorophenyl)-8-methoxy-1,3,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 3422102 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-[3-(3-fluorophenyl)-8-methoxy-1,3,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one |
| SMILES | COc1ccc2c(c1)C1=C(CC2)C(c2cccc(F)c2)N(C(C)=CC(C)=O)N1 |
| InChI | InChI=1S/C23H23FN2O2/c1-14(11-15(2)27)26-23(17-5-4-6-18(24)12-17)20-10-8-16-7-9-19(28-3)13-21(16)22(20)25-26/h4-7,9,11-13,23,25H,8,10H2,1-3H3 |
| InChIKey | ONLOQLAAOCGCFR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|