C24H25N7O4S3 — CID 3422211
N-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3422211) has the molecular formula C24H25N7O4S3 and a molecular weight of 571.71 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3422211 |
| Molecular Formula | C24H25N7O4S3 |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | N-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)C(=O)CSc1nc2ccc(NC(=O)CSc3nnc(-c4cccc([N+](=O)[O-])c4)n3C)cc2s1 |
| InChI | InChI=1S/C24H25N7O4S3/c1-4-30(5-2)21(33)14-37-24-26-18-10-9-16(12-19(18)38-24)25-20(32)13-36-23-28-27-22(29(23)3)15-7-6-8-17(11-15)31(34)35/h6-12H,4-5,13-14H2,1-3H3,(H,25,32) |
| InChIKey | IFEGUXJVXSSULR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|