C12H16N4OS2 — CID 34231417
N-butyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 34231417) has the molecular formula C12H16N4OS2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-butyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-butyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 34231417 |
| Molecular Formula | C12H16N4OS2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-butyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCCNC(=O)Cn1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C12H16N4OS2/c1-2-3-6-13-10(17)8-16-11(14-15-12(16)18)9-5-4-7-19-9/h4-5,7H,2-3,6,8H2,1H3,(H,13,17)(H,15,18) |
| InChIKey | VYIKDXGZEHQXKE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|