C20H18N4O4S2 — CID 3426384
4-[[4-[(4-sulfamoylphenyl)iminomethyl]phenyl]methylideneamino]benzenesulfonamide (PubChem CID 3426384) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[[4-[(4-sulfamoylphenyl)iminomethyl]phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-[[4-[(4-sulfamoylphenyl)iminomethyl]phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 3426384 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 4-[[4-[(4-sulfamoylphenyl)iminomethyl]phenyl]methylideneamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C/c2ccc(/C=N/c3ccc(S(N)(=O)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C20H18N4O4S2/c21-29(25,26)19-9-5-17(6-10-19)23-13-15-1-2-16(4-3-15)14-24-18-7-11-20(12-8-18)30(22,27)28/h1-14H,(H2,21,25,26)(H2,22,27,28)/b23-13+,24-14+ |
| InChIKey | RYZPGOBSXANNKH-RNIAWFEPSA-N |
| XLogP | 2.48 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|