C17H20N2O2S — CID 45483195
4-[(4-tert-butylphenyl)methylideneamino]benzenesulfonamide (PubChem CID 45483195) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 4-[(4-tert-butylphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-[(4-tert-butylphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 45483195 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-[(4-tert-butylphenyl)methylideneamino]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(/C=N/c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-17(2,3)14-6-4-13(5-7-14)12-19-15-8-10-16(11-9-15)22(18,20)21/h4-12H,1-3H3,(H2,18,20,21)/b19-12+ |
| InChIKey | QNBKVIWIMHNHRZ-XDHOZWIPSA-N |
| XLogP | 3.38 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|