C9H10Cl6O4 — CID 3427869
3,9-bis(trichloromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 3427869) has the molecular formula C9H10Cl6O4 and a molecular weight of 394.89 g/mol. Its IUPAC name is 3,9-bis(trichloromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-bis(trichloromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 3427869 |
| Molecular Formula | C9H10Cl6O4 |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 391.87 |
| IUPAC Name | 3,9-bis(trichloromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | ClC(Cl)(Cl)C1OCC2(CO1)COC(C(Cl)(Cl)Cl)OC2 |
| InChI | InChI=1S/C9H10Cl6O4/c10-8(11,12)5-16-1-7(2-17-5)3-18-6(19-4-7)9(13,14)15/h5-6H,1-4H2 |
| InChIKey | LHIAAHFYCAMIEO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|