C17H21N3O2 — CID 3429475
ethyl 4-(N-anilino-C-methylcarbonimidoyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 3429475) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl 4-(N-anilino-C-methylcarbonimidoyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-(N-anilino-C-methylcarbonimidoyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 3429475 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | ethyl 4-(N-anilino-C-methylcarbonimidoyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(C)=NNc2ccccc2)c1C |
| InChI | InChI=1S/C17H21N3O2/c1-5-22-17(21)16-11(2)15(12(3)18-16)13(4)19-20-14-9-7-6-8-10-14/h6-10,18,20H,5H2,1-4H3 |
| InChIKey | AVMTVTRNGPDQPW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|