C22H30N2OS — CID 3430392
1-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(propylamino)ethanone (PubChem CID 3430392) has the molecular formula C22H30N2OS and a molecular weight of 370.56 g/mol. Its IUPAC name is 1-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(propylamino)ethanone.
| Compound Name | 1-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(propylamino)ethanone |
|---|---|
| PubChem CID | 3430392 |
| Molecular Formula | C22H30N2OS |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(propylamino)ethanone |
| SMILES | CCCNCC(=O)N1CCc2sccc2C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N2OS/c1-5-12-23-15-20(25)24-13-10-19-18(11-14-26-19)21(24)16-6-8-17(9-7-16)22(2,3)4/h6-9,11,14,21,23H,5,10,12-13,15H2,1-4H3 |
| InChIKey | WQYFTNZBAQJYDQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|