C21H28N2OS — CID 7360793
1-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(pentylamino)ethanone (PubChem CID 7360793) has the molecular formula C21H28N2OS and a molecular weight of 356.54 g/mol. Its IUPAC name is 1-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(pentylamino)ethanone.
| Compound Name | 1-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(pentylamino)ethanone |
|---|---|
| PubChem CID | 7360793 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(pentylamino)ethanone |
| SMILES | CCCCCNCC(=O)N1CCc2sccc2[C@H]1c1ccccc1C |
| InChI | InChI=1S/C21H28N2OS/c1-3-4-7-12-22-15-20(24)23-13-10-19-18(11-14-25-19)21(23)17-9-6-5-8-16(17)2/h5-6,8-9,11,14,21-22H,3-4,7,10,12-13,15H2,1-2H3/t21-/m1/s1 |
| InChIKey | UFKGKROPRLJXAK-OAQYLSRUSA-N |
| XLogP | 4.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|