C20H27N2OS+ — CID 7495306
butyl-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]azanium (PubChem CID 7495306) has the molecular formula C20H27N2OS+ and a molecular weight of 343.52 g/mol. Its IUPAC name is butyl-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]azanium.
| Compound Name | butyl-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7495306 |
| Molecular Formula | C20H27N2OS+ |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | butyl-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]azanium |
| SMILES | CCCC[NH2+]CC(=O)N1CCc2sccc2[C@@H]1c1ccccc1C |
| InChI | InChI=1S/C20H26N2OS/c1-3-4-11-21-14-19(23)22-12-9-18-17(10-13-24-18)20(22)16-8-6-5-7-15(16)2/h5-8,10,13,20-21H,3-4,9,11-12,14H2,1-2H3/p+1/t20-/m0/s1 |
| InChIKey | MFBUJBDUPJVQKD-FQEVSTJZSA-O |
| XLogP | 2.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|