C23H19ClN2O7 — CID 34312320
2-[(3R)-3'-[(4-chlorophenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-1-yl]acetic acid (PubChem CID 34312320) has the molecular formula C23H19ClN2O7 and a molecular weight of 470.87 g/mol. Its IUPAC name is 2-[(3R)-3'-[(4-chlorophenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-1-yl]acetic acid.
| Compound Name | 2-[(3R)-3'-[(4-chlorophenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-1-yl]acetic acid |
|---|---|
| PubChem CID | 34312320 |
| Molecular Formula | C23H19ClN2O7 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-[(3R)-3'-[(4-chlorophenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-1-yl]acetic acid |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@]12C(=O)N(CC(=O)O)c1ccccc12 |
| InChI | InChI=1S/C23H19ClN2O7/c1-33-11-10-26-21(31)20(30)18(19(29)13-6-8-14(24)9-7-13)23(26)15-4-2-3-5-16(15)25(22(23)32)12-17(27)28/h2-9,29H,10-12H2,1H3,(H,27,28)/t23-/m1/s1 |
| InChIKey | DVVPWUXDLYVTQS-HSZRJFAPSA-N |
| XLogP | 1.99 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|