C23H21FN2O5 — CID 41122906
(3S)-4'-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 41122906) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is (3S)-4'-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (3S)-4'-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 41122906 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (3S)-4'-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1'-(2-methoxyethyl)-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc(C)c(F)c2)[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C23H21FN2O5/c1-13-8-9-14(12-16(13)24)19(27)18-20(28)21(29)26(10-11-31-3)23(18)15-6-4-5-7-17(15)25(2)22(23)30/h4-9,12,27H,10-11H2,1-3H3/t23-/m0/s1 |
| InChIKey | MPGBPACYGZFKQU-QHCPKHFHSA-N |
| XLogP | 2.33 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|