C24H25N3O7S — CID 98327729
3-[(E)-hydroxy-[(3R)-1'-(2-methoxyethyl)-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 98327729) has the molecular formula C24H25N3O7S and a molecular weight of 499.55 g/mol. Its IUPAC name is 3-[(E)-hydroxy-[(3R)-1'-(2-methoxyethyl)-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[(E)-hydroxy-[(3R)-1'-(2-methoxyethyl)-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 98327729 |
| Molecular Formula | C24H25N3O7S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 3-[(E)-hydroxy-[(3R)-1'-(2-methoxyethyl)-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | COCCN1C(=O)C(=O)/C(=C(/O)c2cccc(S(=O)(=O)N(C)C)c2)[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C24H25N3O7S/c1-25(2)35(32,33)16-9-7-8-15(14-16)20(28)19-21(29)22(30)27(12-13-34-4)24(19)17-10-5-6-11-18(17)26(3)23(24)31/h5-11,14,28H,12-13H2,1-4H3/b20-19-/t24-/m1/s1 |
| InChIKey | FKRFRXGHUWPPQD-BOAGOGTPSA-N |
| XLogP | 1.14 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|