C26H30N4O6S — CID 27309328
3-[[(3S)-1'-[2-(dimethylamino)ethyl]-1-ethyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 27309328) has the molecular formula C26H30N4O6S and a molecular weight of 526.62 g/mol. Its IUPAC name is 3-[[(3S)-1'-[2-(dimethylamino)ethyl]-1-ethyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[(3S)-1'-[2-(dimethylamino)ethyl]-1-ethyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 27309328 |
| Molecular Formula | C26H30N4O6S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 3-[[(3S)-1'-[2-(dimethylamino)ethyl]-1-ethyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCN1C(=O)[C@@]2(C(=C(O)c3cccc(S(=O)(=O)N(C)C)c3)C(=O)C(=O)N2CCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C26H30N4O6S/c1-6-29-20-13-8-7-12-19(20)26(25(29)34)21(23(32)24(33)30(26)15-14-27(2)3)22(31)17-10-9-11-18(16-17)37(35,36)28(4)5/h7-13,16,31H,6,14-15H2,1-5H3/t26-/m0/s1 |
| InChIKey | RSAOYNAOACJKSK-SANMLTNESA-N |
| XLogP | 1.44 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|