C30H36N4O7S — CID 73260649
1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1-propylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 73260649) has the molecular formula C30H36N4O7S and a molecular weight of 596.71 g/mol. Its IUPAC name is 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1-propylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1-propylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 73260649 |
| Molecular Formula | C30H36N4O7S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1-propylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CCCN1C(=O)C2(C(=C(O)c3cccc(S(=O)(=O)N4CCOCC4)c3)C(=O)C(=O)N2CCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C30H36N4O7S/c1-4-13-33-24-12-6-5-11-23(24)30(29(33)38)25(27(36)28(37)34(30)15-8-14-31(2)3)26(35)21-9-7-10-22(20-21)42(39,40)32-16-18-41-19-17-32/h5-7,9-12,20,35H,4,8,13-19H2,1-3H3 |
| InChIKey | VZKVEDDKIKRSQF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|