C31H37N3O7S — CID 18820960
(4'Z)-1-butyl-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(3-methoxypropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 18820960) has the molecular formula C31H37N3O7S and a molecular weight of 595.72 g/mol. Its IUPAC name is (4'Z)-1-butyl-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(3-methoxypropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (4'Z)-1-butyl-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(3-methoxypropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 18820960 |
| Molecular Formula | C31H37N3O7S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (4'Z)-1-butyl-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(3-methoxypropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CCCCN1C(=O)C2(/C(=C(/O)c3cccc(S(=O)(=O)N4CCCCC4)c3)C(=O)C(=O)N2CCCOC)c2ccccc21 |
| InChI | InChI=1S/C31H37N3O7S/c1-3-4-18-33-25-15-7-6-14-24(25)31(30(33)38)26(28(36)29(37)34(31)19-11-20-41-2)27(35)22-12-10-13-23(21-22)42(39,40)32-16-8-5-9-17-32/h6-7,10,12-15,21,35H,3-5,8-9,11,16-20H2,1-2H3/b27-26+ |
| InChIKey | WAHMZAFNJZORAH-CYYJNZCTSA-N |
| XLogP | 3.62 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|