C31H36N4O7S — CID 18820899
(4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1-methyl-1'-(3-morpholin-4-ylpropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 18820899) has the molecular formula C31H36N4O7S and a molecular weight of 608.72 g/mol. Its IUPAC name is (4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1-methyl-1'-(3-morpholin-4-ylpropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1-methyl-1'-(3-morpholin-4-ylpropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 18820899 |
| Molecular Formula | C31H36N4O7S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | (4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1-methyl-1'-(3-morpholin-4-ylpropyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CN1C(=O)C2(/C(=C(/O)c3cccc(S(=O)(=O)N4CCCCC4)c3)C(=O)C(=O)N2CCCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C31H36N4O7S/c1-32-25-12-4-3-11-24(25)31(30(32)39)26(28(37)29(38)35(31)16-8-13-33-17-19-42-20-18-33)27(36)22-9-7-10-23(21-22)43(40,41)34-14-5-2-6-15-34/h3-4,7,9-12,21,36H,2,5-6,8,13-20H2,1H3/b27-26+ |
| InChIKey | SPSSMYZVJXQUMR-CYYJNZCTSA-N |
| XLogP | 2.14 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|