C29H31N3O7S — CID 18820987
(4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 18820987) has the molecular formula C29H31N3O7S and a molecular weight of 565.65 g/mol. Its IUPAC name is (4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 18820987 |
| Molecular Formula | C29H31N3O7S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | (4'Z)-4'-[hydroxy-(3-piperidin-1-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | C=CCN1C(=O)C2(/C(=C(/O)c3cccc(S(=O)(=O)N4CCCCC4)c3)C(=O)C(=O)N2CCOC)c2ccccc21 |
| InChI | InChI=1S/C29H31N3O7S/c1-3-14-31-23-13-6-5-12-22(23)29(28(31)36)24(26(34)27(35)32(29)17-18-39-2)25(33)20-10-9-11-21(19-20)40(37,38)30-15-7-4-8-16-30/h3,5-6,9-13,19,33H,1,4,7-8,14-18H2,2H3/b25-24+ |
| InChIKey | ANDONJWCYJRYDM-OCOZRVBESA-N |
| XLogP | 2.62 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|