C26H28N3O4+ — CID 4301793
3-[3'-[hydroxy(phenyl)methylidene]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-1'-yl]propyl-dimethylazanium (PubChem CID 4301793) has the molecular formula C26H28N3O4+ and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[3'-[hydroxy(phenyl)methylidene]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-1'-yl]propyl-dimethylazanium.
| Compound Name | 3-[3'-[hydroxy(phenyl)methylidene]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-1'-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4301793 |
| Molecular Formula | C26H28N3O4+ |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 3-[3'-[hydroxy(phenyl)methylidene]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-1'-yl]propyl-dimethylazanium |
| SMILES | C=CCN1C(=O)C2(C(=C(O)c3ccccc3)C(=O)C(=O)N2CCC[NH+](C)C)c2ccccc21 |
| InChI | InChI=1S/C26H27N3O4/c1-4-15-28-20-14-9-8-13-19(20)26(25(28)33)21(22(30)18-11-6-5-7-12-18)23(31)24(32)29(26)17-10-16-27(2)3/h4-9,11-14,30H,1,10,15-17H2,2-3H3/p+1 |
| InChIKey | MYXCCELZEFBXEU-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|