C28H30N3O5+ — CID 4301789
4'-[hydroxy(phenyl)methylidene]-1'-(3-morpholin-4-ium-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 4301789) has the molecular formula C28H30N3O5+ and a molecular weight of 488.56 g/mol. Its IUPAC name is 4'-[hydroxy(phenyl)methylidene]-1'-(3-morpholin-4-ium-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | 4'-[hydroxy(phenyl)methylidene]-1'-(3-morpholin-4-ium-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 4301789 |
| Molecular Formula | C28H30N3O5+ |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 4'-[hydroxy(phenyl)methylidene]-1'-(3-morpholin-4-ium-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | C=CCN1C(=O)C2(C(=C(O)c3ccccc3)C(=O)C(=O)N2CCC[NH+]2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C28H29N3O5/c1-2-13-30-22-12-7-6-11-21(22)28(27(30)35)23(24(32)20-9-4-3-5-10-20)25(33)26(34)31(28)15-8-14-29-16-18-36-19-17-29/h2-7,9-12,32H,1,8,13-19H2/p+1 |
| InChIKey | ARDRCPWGHOEXKB-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|