C30H33N3O6 — CID 31614614
(3S)-4'-[(4-ethoxyphenyl)-hydroxymethylidene]-1'-(3-morpholin-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 31614614) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is (3S)-4'-[(4-ethoxyphenyl)-hydroxymethylidene]-1'-(3-morpholin-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (3S)-4'-[(4-ethoxyphenyl)-hydroxymethylidene]-1'-(3-morpholin-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 31614614 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | (3S)-4'-[(4-ethoxyphenyl)-hydroxymethylidene]-1'-(3-morpholin-4-ylpropyl)-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | C=CCN1C(=O)[C@@]2(C(=C(O)c3ccc(OCC)cc3)C(=O)C(=O)N2CCCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C30H33N3O6/c1-3-14-32-24-9-6-5-8-23(24)30(29(32)37)25(26(34)21-10-12-22(13-11-21)39-4-2)27(35)28(36)33(30)16-7-15-31-17-19-38-20-18-31/h3,5-6,8-13,34H,1,4,7,14-20H2,2H3/t30-/m0/s1 |
| InChIKey | JMRHOLDBEDHFMS-PMERELPUSA-N |
| XLogP | 2.92 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|