C29H33N3O5 — CID 5096821
1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-propoxyphenyl)methylidene]-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 5096821) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-propoxyphenyl)methylidene]-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-propoxyphenyl)methylidene]-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 5096821 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-propoxyphenyl)methylidene]-1-prop-2-enylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | C=CCN1C(=O)C2(C(=C(O)c3ccc(OCCC)cc3)C(=O)C(=O)N2CCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C29H33N3O5/c1-5-16-31-23-11-8-7-10-22(23)29(28(31)36)24(26(34)27(35)32(29)18-9-17-30(3)4)25(33)20-12-14-21(15-13-20)37-19-6-2/h5,7-8,10-15,33H,1,6,9,16-19H2,2-4H3 |
| InChIKey | AEZJEJOKASGYDO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|