C28H29N3O6 — CID 44666043
(E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1'-[3-(dimethylazaniumyl)propyl]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-3'-ylidene]methanolate (PubChem CID 44666043) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1'-[3-(dimethylazaniumyl)propyl]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-3'-ylidene]methanolate.
| Compound Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1'-[3-(dimethylazaniumyl)propyl]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-3'-ylidene]methanolate |
|---|---|
| PubChem CID | 44666043 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1'-[3-(dimethylazaniumyl)propyl]-2,4',5'-trioxo-1-prop-2-enylspiro[indole-3,2'-pyrrolidine]-3'-ylidene]methanolate |
| SMILES | C=CCN1C(=O)C2(/C(=C(\[O-])c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCC[NH+](C)C)c2ccccc21 |
| InChI | InChI=1S/C28H29N3O6/c1-4-12-30-20-9-6-5-8-19(20)28(27(30)35)23(25(33)26(34)31(28)14-7-13-29(2)3)24(32)18-10-11-21-22(17-18)37-16-15-36-21/h4-6,8-11,17,32H,1,7,12-16H2,2-3H3/b24-23- |
| InChIKey | AOJGNCAVOICNLQ-VHXPQNKSSA-N |
| XLogP | -0.10 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|