C27H31N3O5 — CID 6222760
(E)-[1'-[3-(dimethylazaniumyl)propyl]-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-(4-propoxyphenyl)methanolate (PubChem CID 6222760) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is (E)-[1'-[3-(dimethylazaniumyl)propyl]-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-(4-propoxyphenyl)methanolate.
| Compound Name | (E)-[1'-[3-(dimethylazaniumyl)propyl]-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-(4-propoxyphenyl)methanolate |
|---|---|
| PubChem CID | 6222760 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (E)-[1'-[3-(dimethylazaniumyl)propyl]-1-methyl-2,4',5'-trioxospiro[indole-3,2'-pyrrolidine]-3'-ylidene]-(4-propoxyphenyl)methanolate |
| SMILES | CCCOc1ccc(/C([O-])=C2\C(=O)C(=O)N(CCC[NH+](C)C)C23C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C27H31N3O5/c1-5-17-35-19-13-11-18(12-14-19)23(31)22-24(32)25(33)30(16-8-15-28(2)3)27(22)20-9-6-7-10-21(20)29(4)26(27)34/h6-7,9-14,31H,5,8,15-17H2,1-4H3/b23-22- |
| InChIKey | YFCMRWWXVDSNMH-FCQUAONHSA-N |
| XLogP | 0.36 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|