C27H29N3O8S — CID 18820915
(4'Z)-1-ethyl-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 18820915) has the molecular formula C27H29N3O8S and a molecular weight of 555.61 g/mol. Its IUPAC name is (4'Z)-1-ethyl-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (4'Z)-1-ethyl-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 18820915 |
| Molecular Formula | C27H29N3O8S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | (4'Z)-1-ethyl-4'-[hydroxy-(3-morpholin-4-ylsulfonylphenyl)methylidene]-1'-(2-methoxyethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CCN1C(=O)C2(/C(=C(/O)c3cccc(S(=O)(=O)N4CCOCC4)c3)C(=O)C(=O)N2CCOC)c2ccccc21 |
| InChI | InChI=1S/C27H29N3O8S/c1-3-29-21-10-5-4-9-20(21)27(26(29)34)22(24(32)25(33)30(27)13-14-37-2)23(31)18-7-6-8-19(17-18)39(35,36)28-11-15-38-16-12-28/h4-10,17,31H,3,11-16H2,1-2H3/b23-22+ |
| InChIKey | XWTCWGUTQBEWKP-GHVJWSGMSA-N |
| XLogP | 1.30 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|