C28H32N4O6S — CID 18818881
(4'Z)-1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 18818881) has the molecular formula C28H32N4O6S and a molecular weight of 552.65 g/mol. Its IUPAC name is (4'Z)-1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (4'Z)-1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 18818881 |
| Molecular Formula | C28H32N4O6S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (4'Z)-1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CN(C)CCCN1C(=O)C(=O)/C(=C(\O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C28H32N4O6S/c1-29(2)15-8-18-32-26(35)25(34)23(28(32)21-9-4-5-10-22(21)30(3)27(28)36)24(33)19-11-13-20(14-12-19)39(37,38)31-16-6-7-17-31/h4-5,9-14,33H,6-8,15-18H2,1-3H3/b24-23+ |
| InChIKey | UAXDUFFMZLTUDU-WCWDXBQESA-N |
| XLogP | 1.98 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|